About 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole
2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole (PubChem CID 143851495) has the molecular formula C22H21ClN6O
and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole |
| PubChem CID | 143851495 |
| Molecular Formula | C22H21ClN6O |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole |
| SMILES | CCCNc1ccc(C#N)c(Cl)c1C.c1cnn(-c2ccc(-c3nnco3)cc2)c1 |
| InChI | InChI=1S/C11H13ClN2.C11H8N4O/c1-3-6-14-10-5-4-9(7-13)11(12)8(10)2;1-6-13-15(7-1)10-4-2-9(3-5-10)11-14-12-8-16-11/h4-5,14H,3,6H2,1-2H3;1-8H |
| InChIKey | ZGHMZBBVBKEDNG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole?
The IUPAC name of 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole (CID 143851495) is 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole?
The canonical SMILES for 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole is CCCNc1ccc(C#N)c(Cl)c1C.c1cnn(-c2ccc(-c3nnco3)cc2)c1.
What is the InChIKey of 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole?
The InChIKey is ZGHMZBBVBKEDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2.C11H8N4O/c1-3-6-14-10-5-4-9(7-13)11(12)8(10)2;1-6-13-15(7-1)10-4-2-9(3-5-10)11-14-12-8-16-11/h4-5,14H,3,6H2,1-2H3;1-8H.
What are the key properties of 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole?
2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole has a molecular weight of 420.90 g/mol, XLogP of 5.26, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methyl-4-(propylamino)benzonitrile;2-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazole is sourced from PubChem (CID 143851495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).