C25H39N5O5S2 — CID 143851604
ethane;S-[(E)-4-(5-methyl-6,9,13-trioxo-10-oxa-17-thia-3,7,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2,16(19)-trien-11-yl)but-3-enyl] ethanethioate;propane (PubChem CID 143851604) has the molecular formula C25H39N5O5S2 and a molecular weight of 553.75 g/mol. Its IUPAC name is ethane;S-[(E)-4-(5-methyl-6,9,13-trioxo-10-oxa-17-thia-3,7,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2,16(19)-trien-11-yl)but-3-enyl] ethanethioate;propane.
| Compound Name | ethane;S-[(E)-4-(5-methyl-6,9,13-trioxo-10-oxa-17-thia-3,7,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2,16(19)-trien-11-yl)but-3-enyl] ethanethioate;propane |
|---|---|
| PubChem CID | 143851604 |
| Molecular Formula | C25H39N5O5S2 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | ethane;S-[(E)-4-(5-methyl-6,9,13-trioxo-10-oxa-17-thia-3,7,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2,16(19)-trien-11-yl)but-3-enyl] ethanethioate;propane |
| SMILES | CC.CC(=O)SCC/C=C/C1CC(=O)NCc2nc(cs2)C2=NCC(C)(N2)C(=O)NCC(=O)O1.CCC |
| InChI | InChI=1S/C20H25N5O5S2.C3H8.C2H6/c1-12(26)31-6-4-3-5-13-7-15(27)21-8-16-24-14(10-32-16)18-23-11-20(2,25-18)19(29)22-9-17(28)30-13;1-3-2;1-2/h3,5,10,13H,4,6-9,11H2,1-2H3,(H,21,27)(H,22,29)(H,23,25);3H2,1-2H3;1-2H3/b5-3+;; |
| InChIKey | NAFATGDZWNPLNL-RQCPZROWSA-N |
| XLogP | 2.97 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|