C28H33N7O3 — CID 143851630
1-[1-[2-(17-methyl-8-propan-2-yl-6,9,14,15-tetrazapentacyclo[9.7.0.02,4.05,9.012,16]octadeca-1(11),5,7,12(16),13,17-hexaen-4-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 143851630) has the molecular formula C28H33N7O3 and a molecular weight of 515.62 g/mol. Its IUPAC name is 1-[1-[2-(17-methyl-8-propan-2-yl-6,9,14,15-tetrazapentacyclo[9.7.0.02,4.05,9.012,16]octadeca-1(11),5,7,12(16),13,17-hexaen-4-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 1-[1-[2-(17-methyl-8-propan-2-yl-6,9,14,15-tetrazapentacyclo[9.7.0.02,4.05,9.012,16]octadeca-1(11),5,7,12(16),13,17-hexaen-4-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143851630 |
| Molecular Formula | C28H33N7O3 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 1-[1-[2-(17-methyl-8-propan-2-yl-6,9,14,15-tetrazapentacyclo[9.7.0.02,4.05,9.012,16]octadeca-1(11),5,7,12(16),13,17-hexaen-4-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1cc2c(c3cn[nH]c13)Cn1c(C(C)C)cnc1C1(CC(=O)N3CCC(N4CC(=O)NC4=O)CC3)CC21 |
| InChI | InChI=1S/C28H33N7O3/c1-15(2)22-12-29-26-28(10-24(37)33-6-4-17(5-7-33)34-14-23(36)31-27(34)38)9-21(28)18-8-16(3)25-19(11-30-32-25)20(18)13-35(22)26/h8,11-12,15,17,21H,4-7,9-10,13-14H2,1-3H3,(H,30,32)(H,31,36,38) |
| InChIKey | XEHZIWPVBQGTLV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|