C29H26N2O6S — CID 143851669
(2Z)-N-[4-[4-[(3E,4E)-3,4-di(ethylidene)-2,5-dioxopyrrolidin-1-yl]phenyl]sulfonylphenyl]-2-ethenyl-3-formyl-N-methylpenta-2,4-dienamide (PubChem CID 143851669) has the molecular formula C29H26N2O6S and a molecular weight of 530.60 g/mol. Its IUPAC name is (2Z)-N-[4-[4-[(3E,4E)-3,4-di(ethylidene)-2,5-dioxopyrrolidin-1-yl]phenyl]sulfonylphenyl]-2-ethenyl-3-formyl-N-methylpenta-2,4-dienamide.
| Compound Name | (2Z)-N-[4-[4-[(3E,4E)-3,4-di(ethylidene)-2,5-dioxopyrrolidin-1-yl]phenyl]sulfonylphenyl]-2-ethenyl-3-formyl-N-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 143851669 |
| Molecular Formula | C29H26N2O6S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | (2Z)-N-[4-[4-[(3E,4E)-3,4-di(ethylidene)-2,5-dioxopyrrolidin-1-yl]phenyl]sulfonylphenyl]-2-ethenyl-3-formyl-N-methylpenta-2,4-dienamide |
| SMILES | C=C/C(C=O)=C(\C=C)C(=O)N(C)c1ccc(S(=O)(=O)c2ccc(N3C(=O)C(=C/C)/C(=C\C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C29H26N2O6S/c1-6-19(18-32)24(7-2)27(33)30(5)20-10-14-22(15-11-20)38(36,37)23-16-12-21(13-17-23)31-28(34)25(8-3)26(9-4)29(31)35/h6-18H,1-2H2,3-5H3/b24-19-,25-8+,26-9+ |
| InChIKey | USRSDTKFQAAYAP-IFJYIISPSA-N |
| XLogP | 4.12 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|