C29H45NO4 — CID 143852170
(4E,11S,16E)-12-anilino-6,15-dihydroxy-5,9,11,17-tetramethylnonadeca-4,16-diene-2,8-dione (PubChem CID 143852170) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is (4E,11S,16E)-12-anilino-6,15-dihydroxy-5,9,11,17-tetramethylnonadeca-4,16-diene-2,8-dione.
| Compound Name | (4E,11S,16E)-12-anilino-6,15-dihydroxy-5,9,11,17-tetramethylnonadeca-4,16-diene-2,8-dione |
|---|---|
| PubChem CID | 143852170 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | (4E,11S,16E)-12-anilino-6,15-dihydroxy-5,9,11,17-tetramethylnonadeca-4,16-diene-2,8-dione |
| SMILES | CC/C(C)=C/C(O)CCC(Nc1ccccc1)[C@@H](C)CC(C)C(=O)CC(O)/C(C)=C/CC(C)=O |
| InChI | InChI=1S/C29H45NO4/c1-7-20(2)17-26(32)15-16-27(30-25-11-9-8-10-12-25)22(4)18-23(5)29(34)19-28(33)21(3)13-14-24(6)31/h8-13,17,22-23,26-28,30,32-33H,7,14-16,18-19H2,1-6H3/b20-17+,21-13+/t22-,23?,26?,27?,28?/m0/s1 |
| InChIKey | VOSYICNDTOYSDC-YJWARLKUSA-N |
| XLogP | 5.87 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|