C24H10Cl2F4N2O12S — CID 143852319
[4-[6-(4-chloro-4-oxobutanoyl)oxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]oxysulfinyl-2,3,5,6-tetrafluorophenyl] 4-chloro-4-oxobutanoate (PubChem CID 143852319) has the molecular formula C24H10Cl2F4N2O12S and a molecular weight of 697.31 g/mol. Its IUPAC name is [4-[6-(4-chloro-4-oxobutanoyl)oxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]oxysulfinyl-2,3,5,6-tetrafluorophenyl] 4-chloro-4-oxobutanoate.
| Compound Name | [4-[6-(4-chloro-4-oxobutanoyl)oxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]oxysulfinyl-2,3,5,6-tetrafluorophenyl] 4-chloro-4-oxobutanoate |
|---|---|
| PubChem CID | 143852319 |
| Molecular Formula | C24H10Cl2F4N2O12S |
| Molecular Weight | 697.31 g/mol |
| Exact Mass | 695.93 |
| IUPAC Name | [4-[6-(4-chloro-4-oxobutanoyl)oxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]oxysulfinyl-2,3,5,6-tetrafluorophenyl] 4-chloro-4-oxobutanoate |
| SMILES | O=C(Cl)CCC(=O)Oc1c(F)c(F)c(S(=O)On2c(=O)c3cc4c(=O)n(OC(=O)CCC(=O)Cl)c(=O)c4cc3c2=O)c(F)c1F |
| InChI | InChI=1S/C24H10Cl2F4N2O12S/c25-11(33)1-3-13(35)42-19-15(27)17(29)20(18(30)16(19)28)45(41)44-32-23(39)9-5-7-8(6-10(9)24(32)40)22(38)31(21(7)37)43-14(36)4-2-12(26)34/h5-6H,1-4H2 |
| InChIKey | LQLIYLMARARWEI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 191.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|