C31H26F4N2O15S2 — CID 143852329
[5-[4-[2-(4-acetyloxy-2,3,5,6-tetrafluorophenyl)sulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]oxy-4-oxobutanoyl]oxy-2,5-dimethylhexan-2-yl]oxymethanethioic S-acid (PubChem CID 143852329) has the molecular formula C31H26F4N2O15S2 and a molecular weight of 806.67 g/mol. Its IUPAC name is [5-[4-[2-(4-acetyloxy-2,3,5,6-tetrafluorophenyl)sulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]oxy-4-oxobutanoyl]oxy-2,5-dimethylhexan-2-yl]oxymethanethioic S-acid.
| Compound Name | [5-[4-[2-(4-acetyloxy-2,3,5,6-tetrafluorophenyl)sulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]oxy-4-oxobutanoyl]oxy-2,5-dimethylhexan-2-yl]oxymethanethioic S-acid |
|---|---|
| PubChem CID | 143852329 |
| Molecular Formula | C31H26F4N2O15S2 |
| Molecular Weight | 806.67 g/mol |
| Exact Mass | 806.07 |
| IUPAC Name | [5-[4-[2-(4-acetyloxy-2,3,5,6-tetrafluorophenyl)sulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]oxy-4-oxobutanoyl]oxy-2,5-dimethylhexan-2-yl]oxymethanethioic S-acid |
| SMILES | CC(=O)Oc1c(F)c(F)c(S(=O)(=O)On2c(=O)c3cc4c(=O)n(OC(=O)CCC(=O)OC(C)(C)CCC(C)(C)OC(=O)S)c(=O)c4cc3c2=O)c(F)c1F |
| InChI | InChI=1S/C31H26F4N2O15S2/c1-12(38)48-23-19(32)21(34)24(22(35)20(23)33)54(46,47)52-37-27(43)15-10-13-14(11-16(15)28(37)44)26(42)36(25(13)41)51-18(40)7-6-17(39)49-30(2,3)8-9-31(4,5)50-29(45)53/h10-11H,6-9H2,1-5H3,(H,45,53) |
| InChIKey | JQCFOAZVHXVBMV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 226.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.67 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|