C33H18N4O14S2 — CID 143852336
[(6-formyl-2-hydroxy-1,3-dioxoisoindole-5-carbonyl)-methylamino] 4-[4-(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)oxysulfanylphenoxy]benzenesulfinate (PubChem CID 143852336) has the molecular formula C33H18N4O14S2 and a molecular weight of 758.66 g/mol. Its IUPAC name is [(6-formyl-2-hydroxy-1,3-dioxoisoindole-5-carbonyl)-methylamino] 4-[4-(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)oxysulfanylphenoxy]benzenesulfinate.
| Compound Name | [(6-formyl-2-hydroxy-1,3-dioxoisoindole-5-carbonyl)-methylamino] 4-[4-(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)oxysulfanylphenoxy]benzenesulfinate |
|---|---|
| PubChem CID | 143852336 |
| Molecular Formula | C33H18N4O14S2 |
| Molecular Weight | 758.66 g/mol |
| Exact Mass | 758.03 |
| IUPAC Name | [(6-formyl-2-hydroxy-1,3-dioxoisoindole-5-carbonyl)-methylamino] 4-[4-(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)oxysulfanylphenoxy]benzenesulfinate |
| SMILES | CN(OS(=O)c1ccc(Oc2ccc(SOn3c(=O)c4cc5c(=O)n(O)c(=O)c5cc4c3=O)cc2)cc1)C(=O)c1cc2c(cc1C=O)C(=O)N(O)C2=O |
| InChI | InChI=1S/C33H18N4O14S2/c1-34(27(39)20-11-22-21(10-15(20)14-38)28(40)35(46)29(22)41)51-53(48)19-8-4-17(5-9-19)49-16-2-6-18(7-3-16)52-50-37-32(44)25-12-23-24(13-26(25)33(37)45)31(43)36(47)30(23)42/h2-14,46-47H,1H3 |
| InChIKey | LKRRUJWFVBBSJR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 238.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.66 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|