C7H9N3OS — CID 143852548
6-sulfanyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-one (PubChem CID 143852548) has the molecular formula C7H9N3OS and a molecular weight of 183.24 g/mol. Its IUPAC name is 6-sulfanyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 6-sulfanyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 143852548 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-sulfanyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-one |
| SMILES | O=c1ncc2c([nH]1)CCN(S)C2 |
| InChI | InChI=1S/C7H9N3OS/c11-7-8-3-5-4-10(12)2-1-6(5)9-7/h3,12H,1-2,4H2,(H,8,9,11) |
| InChIKey | NPMRYARVXGJVRZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|