About 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine
4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine (PubChem CID 143852914) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine.
Molecular Properties
| Compound Name | 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine |
| PubChem CID | 143852914 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine |
| SMILES | C=C/C=C(\C=C)COCCCCN |
| InChI | InChI=1S/C11H19NO/c1-3-7-11(4-2)10-13-9-6-5-8-12/h3-4,7H,1-2,5-6,8-10,12H2/b11-7+ |
| InChIKey | QYQKHVIAQLAEPT-YRNVUSSQSA-N |
| XLogP | 2.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine?
The IUPAC name of 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine (CID 143852914) is 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine.
What is the SMILES notation for 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine?
The canonical SMILES for 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine is C=C/C=C(\C=C)COCCCCN.
What is the InChIKey of 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine?
The InChIKey is QYQKHVIAQLAEPT-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-7-11(4-2)10-13-9-6-5-8-12/h3-4,7H,1-2,5-6,8-10,12H2/b11-7+.
What are the key properties of 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine?
4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine has a molecular weight of 181.28 g/mol, XLogP of 2.04, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine is sourced from PubChem (CID 143852914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).