C33H40N4O2 — CID 143853038
(E)-N-[[3-(2-aminoethyl)-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 143853038) has the molecular formula C33H40N4O2 and a molecular weight of 524.71 g/mol. Its IUPAC name is (E)-N-[[3-(2-aminoethyl)-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-(2-aminoethyl)-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 143853038 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | (E)-N-[[3-(2-aminoethyl)-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NCC2CCN(CC(c3ccccc3)c3ccccc3)C(=O)C(CCN)N2)c(C)c1 |
| InChI | InChI=1S/C33H40N4O2/c1-24-13-14-26(25(2)21-24)15-16-32(38)35-22-29-18-20-37(33(39)31(36-29)17-19-34)23-30(27-9-5-3-6-10-27)28-11-7-4-8-12-28/h3-16,21,29-31,36H,17-20,22-23,34H2,1-2H3,(H,35,38)/b16-15+ |
| InChIKey | SGWSXQNNJDWEEJ-FOCLMDBBSA-N |
| XLogP | 4.17 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|