About cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane
cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane (PubChem CID 143853228) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane |
| PubChem CID | 143853228 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane |
| SMILES | CC.CCCNC(=O)OCC1=CCCC=C1 |
| InChI | InChI=1S/C11H17NO2.C2H6/c1-2-8-12-11(13)14-9-10-6-4-3-5-7-10;1-2/h4,6-7H,2-3,5,8-9H2,1H3,(H,12,13);1-2H3 |
| InChIKey | ZJKBDWCQQYKWCG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane (CID 143853228) is cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane is CC.CCCNC(=O)OCC1=CCCC=C1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane?
The InChIKey is ZJKBDWCQQYKWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2.C2H6/c1-2-8-12-11(13)14-9-10-6-4-3-5-7-10;1-2/h4,6-7H,2-3,5,8-9H2,1H3,(H,12,13);1-2H3.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane?
cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane has a molecular weight of 225.33 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;ethane is sourced from PubChem (CID 143853228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).