About 2,4-dimethyl-1,3-thiazole;2-methylfuran
2,4-dimethyl-1,3-thiazole;2-methylfuran (PubChem CID 143853297) has the molecular formula C10H13NOS
and a molecular weight of 195.29 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-thiazole;2-methylfuran.
Molecular Properties
| Compound Name | 2,4-dimethyl-1,3-thiazole;2-methylfuran |
| PubChem CID | 143853297 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2,4-dimethyl-1,3-thiazole;2-methylfuran |
| SMILES | Cc1ccco1.Cc1csc(C)n1 |
| InChI | InChI=1S/C5H7NS.C5H6O/c1-4-3-7-5(2)6-4;1-5-3-2-4-6-5/h3H,1-2H3;2-4H,1H3 |
| InChIKey | JKLSTFOLOYQAQY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-1,3-thiazole;2-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1,3-thiazole;2-methylfuran?
The IUPAC name of 2,4-dimethyl-1,3-thiazole;2-methylfuran (CID 143853297) is 2,4-dimethyl-1,3-thiazole;2-methylfuran.
What is the SMILES notation for 2,4-dimethyl-1,3-thiazole;2-methylfuran?
The canonical SMILES for 2,4-dimethyl-1,3-thiazole;2-methylfuran is Cc1ccco1.Cc1csc(C)n1.
What is the InChIKey of 2,4-dimethyl-1,3-thiazole;2-methylfuran?
The InChIKey is JKLSTFOLOYQAQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NS.C5H6O/c1-4-3-7-5(2)6-4;1-5-3-2-4-6-5/h3H,1-2H3;2-4H,1H3.
What are the key properties of 2,4-dimethyl-1,3-thiazole;2-methylfuran?
2,4-dimethyl-1,3-thiazole;2-methylfuran has a molecular weight of 195.29 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1,3-thiazole;2-methylfuran is sourced from PubChem (CID 143853297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).