C13H29NO3 — CID 143853511
(6R)-4-(dimethylamino)-6-methyloxan-2-ol;ethane;prop-2-en-1-ol (PubChem CID 143853511) has the molecular formula C13H29NO3 and a molecular weight of 247.38 g/mol. Its IUPAC name is (6R)-4-(dimethylamino)-6-methyloxan-2-ol;ethane;prop-2-en-1-ol.
| Compound Name | (6R)-4-(dimethylamino)-6-methyloxan-2-ol;ethane;prop-2-en-1-ol |
|---|---|
| PubChem CID | 143853511 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | (6R)-4-(dimethylamino)-6-methyloxan-2-ol;ethane;prop-2-en-1-ol |
| SMILES | C=CCO.CC.C[C@@H]1CC(N(C)C)CC(O)O1 |
| InChI | InChI=1S/C8H17NO2.C3H6O.C2H6/c1-6-4-7(9(2)3)5-8(10)11-6;1-2-3-4;1-2/h6-8,10H,4-5H2,1-3H3;2,4H,1,3H2;1-2H3/t6-,7?,8?;;/m1../s1 |
| InChIKey | WTCJDKQUMLPDCU-YOBDIHPQSA-N |
| XLogP | 1.62 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|