C22H36O6 — CID 143853564
(1R,2R,5R,7R,11R,13R)-2-ethyl-1,5,7,9,11,13-hexamethyl-3,15,17-trioxabicyclo[12.3.0]heptadecane-4,12,16-trione (PubChem CID 143853564) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is (1R,2R,5R,7R,11R,13R)-2-ethyl-1,5,7,9,11,13-hexamethyl-3,15,17-trioxabicyclo[12.3.0]heptadecane-4,12,16-trione.
| Compound Name | (1R,2R,5R,7R,11R,13R)-2-ethyl-1,5,7,9,11,13-hexamethyl-3,15,17-trioxabicyclo[12.3.0]heptadecane-4,12,16-trione |
|---|---|
| PubChem CID | 143853564 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (1R,2R,5R,7R,11R,13R)-2-ethyl-1,5,7,9,11,13-hexamethyl-3,15,17-trioxabicyclo[12.3.0]heptadecane-4,12,16-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C[C@H](C)CC(C)C[C@@H](C)C(=O)[C@H](C)C2OC(=O)O[C@@]21C |
| InChI | InChI=1S/C22H36O6/c1-8-17-22(7)19(27-21(25)28-22)16(6)18(23)14(4)10-12(2)9-13(3)11-15(5)20(24)26-17/h12-17,19H,8-11H2,1-7H3/t12?,13-,14-,15-,16+,17-,19?,22-/m1/s1 |
| InChIKey | SHEYYIPFLQJPTD-QLPOQIQBSA-N |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |