About 5-imino-2,2-dimethyl-4-methylidenehexan-3-one
5-imino-2,2-dimethyl-4-methylidenehexan-3-one (PubChem CID 143854044) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 5-imino-2,2-dimethyl-4-methylidenehexan-3-one.
Molecular Properties
| Compound Name | 5-imino-2,2-dimethyl-4-methylidenehexan-3-one |
| PubChem CID | 143854044 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 5-imino-2,2-dimethyl-4-methylidenehexan-3-one |
| SMILES | [H]/N=C(\C)C(=C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C9H15NO/c1-6(7(2)10)8(11)9(3,4)5/h10H,1H2,2-5H3/b10-7+ |
| InChIKey | QFEWUSCFZNJWRO-JXMROGBWSA-N |
| XLogP | 2.20 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-imino-2,2-dimethyl-4-methylidenehexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-2,2-dimethyl-4-methylidenehexan-3-one?
The IUPAC name of 5-imino-2,2-dimethyl-4-methylidenehexan-3-one (CID 143854044) is 5-imino-2,2-dimethyl-4-methylidenehexan-3-one.
What is the SMILES notation for 5-imino-2,2-dimethyl-4-methylidenehexan-3-one?
The canonical SMILES for 5-imino-2,2-dimethyl-4-methylidenehexan-3-one is [H]/N=C(\C)C(=C)C(=O)C(C)(C)C.
What is the InChIKey of 5-imino-2,2-dimethyl-4-methylidenehexan-3-one?
The InChIKey is QFEWUSCFZNJWRO-JXMROGBWSA-N. The full InChI is InChI=1S/C9H15NO/c1-6(7(2)10)8(11)9(3,4)5/h10H,1H2,2-5H3/b10-7+.
What are the key properties of 5-imino-2,2-dimethyl-4-methylidenehexan-3-one?
5-imino-2,2-dimethyl-4-methylidenehexan-3-one has a molecular weight of 153.22 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-2,2-dimethyl-4-methylidenehexan-3-one is sourced from PubChem (CID 143854044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).