C24H21FN4OS — CID 143854093
[2-(benzhydrylideneamino)-7-(2,2-dimethylpropanoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite (PubChem CID 143854093) has the molecular formula C24H21FN4OS and a molecular weight of 432.52 g/mol. Its IUPAC name is [2-(benzhydrylideneamino)-7-(2,2-dimethylpropanoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite.
| Compound Name | [2-(benzhydrylideneamino)-7-(2,2-dimethylpropanoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
|---|---|
| PubChem CID | 143854093 |
| Molecular Formula | C24H21FN4OS |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [2-(benzhydrylideneamino)-7-(2,2-dimethylpropanoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
| SMILES | CC(C)(C)C(=O)c1cn(SF)c2ncc(N=C(c3ccccc3)c3ccccc3)nc12 |
| InChI | InChI=1S/C24H21FN4OS/c1-24(2,3)22(30)18-15-29(31-25)23-21(18)28-19(14-26-23)27-20(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-15H,1-3H3 |
| InChIKey | UFGSYCPTIBOXRF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|