About ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane
ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane (PubChem CID 143855395) has the molecular formula C16H28O
and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane.
Molecular Properties
| Compound Name | ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane |
| PubChem CID | 143855395 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane |
| SMILES | C=C/C=C(\C=C)COC1CCCCC1C.CC |
| InChI | InChI=1S/C14H22O.C2H6/c1-4-8-13(5-2)11-15-14-10-7-6-9-12(14)3;1-2/h4-5,8,12,14H,1-2,6-7,9-11H2,3H3;1-2H3/b13-8+; |
| InChIKey | SZYBDYQIPOIVEV-FNXZNAJJSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane?
The IUPAC name of ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane (CID 143855395) is ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane.
What is the SMILES notation for ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane?
The canonical SMILES for ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane is C=C/C=C(\C=C)COC1CCCCC1C.CC.
What is the InChIKey of ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane?
The InChIKey is SZYBDYQIPOIVEV-FNXZNAJJSA-N. The full InChI is InChI=1S/C14H22O.C2H6/c1-4-8-13(5-2)11-15-14-10-7-6-9-12(14)3;1-2/h4-5,8,12,14H,1-2,6-7,9-11H2,3H3;1-2H3/b13-8+;.
What are the key properties of ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane?
ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane has a molecular weight of 236.40 g/mol, XLogP of 4.91, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-methylcyclohexane is sourced from PubChem (CID 143855395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).