About ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide
ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide (PubChem CID 143855420) has the molecular formula C15H31NO3
and a molecular weight of 273.42 g/mol. Its IUPAC name is ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide |
| PubChem CID | 143855420 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide |
| SMILES | CC.CC(C(=O)NCC1(O)CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C13H25NO3.C2H6/c1-10(12(2,3)4)11(15)14-9-13(16)5-7-17-8-6-13;1-2/h10,16H,5-9H2,1-4H3,(H,14,15);1-2H3 |
| InChIKey | MKJIABUREMRLRI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide?
The IUPAC name of ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide (CID 143855420) is ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide.
What is the SMILES notation for ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide?
The canonical SMILES for ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide is CC.CC(C(=O)NCC1(O)CCOCC1)C(C)(C)C.
What is the InChIKey of ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide?
The InChIKey is MKJIABUREMRLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3.C2H6/c1-10(12(2,3)4)11(15)14-9-13(16)5-7-17-8-6-13;1-2/h10,16H,5-9H2,1-4H3,(H,14,15);1-2H3.
What are the key properties of ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide?
ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide has a molecular weight of 273.42 g/mol, XLogP of 2.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(4-hydroxyoxan-4-yl)methyl]-2,3,3-trimethylbutanamide is sourced from PubChem (CID 143855420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).