About 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane
2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane (PubChem CID 143855473) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane |
| PubChem CID | 143855473 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane |
| SMILES | CC.Cc1oc(C(C)C(C)(C)C)nc1C(=O)O |
| InChI | InChI=1S/C11H17NO3.C2H6/c1-6(11(3,4)5)9-12-8(10(13)14)7(2)15-9;1-2/h6H,1-5H3,(H,13,14);1-2H3 |
| InChIKey | LGDHFQGDOBHFTH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane?
The IUPAC name of 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane (CID 143855473) is 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane.
What is the SMILES notation for 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane?
The canonical SMILES for 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane is CC.Cc1oc(C(C)C(C)(C)C)nc1C(=O)O.
What is the InChIKey of 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane?
The InChIKey is LGDHFQGDOBHFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3.C2H6/c1-6(11(3,4)5)9-12-8(10(13)14)7(2)15-9;1-2/h6H,1-5H3,(H,13,14);1-2H3.
What are the key properties of 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane?
2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane has a molecular weight of 241.33 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid;ethane is sourced from PubChem (CID 143855473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).