About N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide
N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide (PubChem CID 143855685) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide |
| PubChem CID | 143855685 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide |
| SMILES | CC(C(=O)NC1(CO)CC1)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-8(10(2,3)4)9(14)12-11(7-13)5-6-11/h8,13H,5-7H2,1-4H3,(H,12,14) |
| InChIKey | BYQCFZQAWUDFAV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide?
The IUPAC name of N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide (CID 143855685) is N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide.
What is the SMILES notation for N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide?
The canonical SMILES for N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide is CC(C(=O)NC1(CO)CC1)C(C)(C)C.
What is the InChIKey of N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide?
The InChIKey is BYQCFZQAWUDFAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-8(10(2,3)4)9(14)12-11(7-13)5-6-11/h8,13H,5-7H2,1-4H3,(H,12,14).
What are the key properties of N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide?
N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide has a molecular weight of 199.29 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(hydroxymethyl)cyclopropyl]-2,3,3-trimethylbutanamide is sourced from PubChem (CID 143855685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).