C28H27FN2S — CID 143856122
2-[3-[(2R)-2-fluoro-3-methylpentan-3-yl]dibenzothiophen-2-yl]-1-(2-methylphenyl)imidazole (PubChem CID 143856122) has the molecular formula C28H27FN2S and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-[3-[(2R)-2-fluoro-3-methylpentan-3-yl]dibenzothiophen-2-yl]-1-(2-methylphenyl)imidazole.
| Compound Name | 2-[3-[(2R)-2-fluoro-3-methylpentan-3-yl]dibenzothiophen-2-yl]-1-(2-methylphenyl)imidazole |
|---|---|
| PubChem CID | 143856122 |
| Molecular Formula | C28H27FN2S |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-[3-[(2R)-2-fluoro-3-methylpentan-3-yl]dibenzothiophen-2-yl]-1-(2-methylphenyl)imidazole |
| SMILES | CCC(C)(c1cc2sc3ccccc3c2cc1-c1nccn1-c1ccccc1C)[C@@H](C)F |
| InChI | InChI=1S/C28H27FN2S/c1-5-28(4,19(3)29)23-17-26-21(20-11-7-9-13-25(20)32-26)16-22(23)27-30-14-15-31(27)24-12-8-6-10-18(24)2/h6-17,19H,5H2,1-4H3/t19-,28?/m1/s1 |
| InChIKey | PKFQWQOGFOSTCV-OJQMSQGESA-N |
| XLogP | 8.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |