About methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate
methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate (PubChem CID 143856500) has the molecular formula C14H17ClO4
and a molecular weight of 284.74 g/mol. Its IUPAC name is methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate |
| PubChem CID | 143856500 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate |
| SMILES | CCC1=C(COC(C)=O)C=CC(C(=O)OC)=C(Cl)C1 |
| InChI | InChI=1S/C14H17ClO4/c1-4-10-7-13(15)12(14(17)18-3)6-5-11(10)8-19-9(2)16/h5-6H,4,7-8H2,1-3H3 |
| InChIKey | QZYWWTWPRVQNED-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate?
The IUPAC name of methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate (CID 143856500) is methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate.
What is the SMILES notation for methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate?
The canonical SMILES for methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate is CCC1=C(COC(C)=O)C=CC(C(=O)OC)=C(Cl)C1.
What is the InChIKey of methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate?
The InChIKey is QZYWWTWPRVQNED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO4/c1-4-10-7-13(15)12(14(17)18-3)6-5-11(10)8-19-9(2)16/h5-6H,4,7-8H2,1-3H3.
What are the key properties of methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate?
methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate has a molecular weight of 284.74 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(acetyloxymethyl)-2-chloro-4-ethylcyclohepta-1,4,6-triene-1-carboxylate is sourced from PubChem (CID 143856500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).