C22H22N2O4S — CID 143856722
ethyl 3-hydroxy-5-[(1-methyl-2,5-dihydroazepin-7-yl)methyl]-4-oxothieno[3,2-c]quinoline-2-carboxylate (PubChem CID 143856722) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is ethyl 3-hydroxy-5-[(1-methyl-2,5-dihydroazepin-7-yl)methyl]-4-oxothieno[3,2-c]quinoline-2-carboxylate.
| Compound Name | ethyl 3-hydroxy-5-[(1-methyl-2,5-dihydroazepin-7-yl)methyl]-4-oxothieno[3,2-c]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 143856722 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | ethyl 3-hydroxy-5-[(1-methyl-2,5-dihydroazepin-7-yl)methyl]-4-oxothieno[3,2-c]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(c1O)c(=O)n(CC1=CCC=CCN1C)c1ccccc21 |
| InChI | InChI=1S/C22H22N2O4S/c1-3-28-22(27)20-18(25)17-19(29-20)15-10-6-7-11-16(15)24(21(17)26)13-14-9-5-4-8-12-23(14)2/h4,6-11,25H,3,5,12-13H2,1-2H3 |
| InChIKey | LUGQESZCVYHZKY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|