C11H16N2 — CID 143857333
(7aS)-6-methanimidoyl-7a-methyl-1,2,3,7-tetrahydroinden-5-amine (PubChem CID 143857333) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (7aS)-6-methanimidoyl-7a-methyl-1,2,3,7-tetrahydroinden-5-amine.
| Compound Name | (7aS)-6-methanimidoyl-7a-methyl-1,2,3,7-tetrahydroinden-5-amine |
|---|---|
| PubChem CID | 143857333 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (7aS)-6-methanimidoyl-7a-methyl-1,2,3,7-tetrahydroinden-5-amine |
| SMILES | [H]/N=C/C1=C(N)C=C2CCC[C@@]2(C)C1 |
| InChI | InChI=1S/C11H16N2/c1-11-4-2-3-9(11)5-10(13)8(6-11)7-12/h5,7,12H,2-4,6,13H2,1H3/b12-7+/t11-/m0/s1 |
| InChIKey | TXBYGEFRVKACQK-WBOGTDJTSA-N |
| XLogP | 2.37 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|