C19H21FN2 — CID 143857373
12-(4-fluorocyclohexa-1,3-dien-1-yl)-12,13-diazatetracyclo[8.4.1.03,5.03,8]pentadeca-1(15),8,13-triene (PubChem CID 143857373) has the molecular formula C19H21FN2 and a molecular weight of 296.39 g/mol. Its IUPAC name is 12-(4-fluorocyclohexa-1,3-dien-1-yl)-12,13-diazatetracyclo[8.4.1.03,5.03,8]pentadeca-1(15),8,13-triene.
| Compound Name | 12-(4-fluorocyclohexa-1,3-dien-1-yl)-12,13-diazatetracyclo[8.4.1.03,5.03,8]pentadeca-1(15),8,13-triene |
|---|---|
| PubChem CID | 143857373 |
| Molecular Formula | C19H21FN2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 12-(4-fluorocyclohexa-1,3-dien-1-yl)-12,13-diazatetracyclo[8.4.1.03,5.03,8]pentadeca-1(15),8,13-triene |
| SMILES | FC1=CC=C(N2CC3C=C(C=N2)CC24CC2CCC4=C3)CC1 |
| InChI | InChI=1S/C19H21FN2/c20-17-3-5-18(6-4-17)22-12-13-7-14(11-21-22)9-19-10-16(19)2-1-15(19)8-13/h3,5,7-8,11,13,16H,1-2,4,6,9-10,12H2 |
| InChIKey | WIQPVBDVSCWJQL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|