C11H16N2 — CID 143857704
1,6,6-trimethyl-2,3-dihydropyrrolo[3,2-b]azepine (PubChem CID 143857704) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,6,6-trimethyl-2,3-dihydropyrrolo[3,2-b]azepine.
| Compound Name | 1,6,6-trimethyl-2,3-dihydropyrrolo[3,2-b]azepine |
|---|---|
| PubChem CID | 143857704 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,6,6-trimethyl-2,3-dihydropyrrolo[3,2-b]azepine |
| SMILES | CN1CCC2=C1C=CC(C)(C)C=N2 |
| InChI | InChI=1S/C11H16N2/c1-11(2)6-4-10-9(12-8-11)5-7-13(10)3/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | DHNIXWRAJTVXFF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |