About 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese
2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese (PubChem CID 143858480) has the molecular formula C21H25Cl2MnN5O3
and a molecular weight of 521.31 g/mol. Its IUPAC name is 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese.
Molecular Properties
| Compound Name | 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese |
| PubChem CID | 143858480 |
| Molecular Formula | C21H25Cl2MnN5O3 |
| Molecular Weight | 521.31 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese |
| SMILES | CN(CCO)c1ccnc(-c2cc(O)cc(-c3cc(N(C)CCO)ccn3)n2)c1.Cl[Mn]Cl |
| InChI | InChI=1S/C21H25N5O3.2ClH.Mn/c1-25(7-9-27)15-3-5-22-18(11-15)20-13-17(29)14-21(24-20)19-12-16(4-6-23-19)26(2)8-10-28;;;/h3-6,11-14,27-28H,7-10H2,1-2H3,(H,24,29);2*1H;/q;;;+2/p-2 |
| InChIKey | LAIVBIIEXNVVDC-UHFFFAOYSA-L |
| XLogP | 3.14 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese?
The IUPAC name of 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese (CID 143858480) is 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese.
What is the SMILES notation for 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese?
The canonical SMILES for 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese is CN(CCO)c1ccnc(-c2cc(O)cc(-c3cc(N(C)CCO)ccn3)n2)c1.Cl[Mn]Cl.
What is the InChIKey of 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese?
The InChIKey is LAIVBIIEXNVVDC-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H25N5O3.2ClH.Mn/c1-25(7-9-27)15-3-5-22-18(11-15)20-13-17(29)14-21(24-20)19-12-16(4-6-23-19)26(2)8-10-28;;;/h3-6,11-14,27-28H,7-10H2,1-2H3,(H,24,29);2*1H;/q;;;+2/p-2.
What are the key properties of 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese?
2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese has a molecular weight of 521.31 g/mol, XLogP of 3.14, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[4-[2-hydroxyethyl(methyl)amino]-2-pyridinyl]pyridin-4-ol;dichloromanganese is sourced from PubChem (CID 143858480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).