C44H42N2 — CID 143859069
N-(4-tert-butylphenyl)-4-[9-(4-tert-butylphenyl)carbazol-3-yl]-N-phenylaniline (PubChem CID 143859069) has the molecular formula C44H42N2 and a molecular weight of 598.83 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-[9-(4-tert-butylphenyl)carbazol-3-yl]-N-phenylaniline.
| Compound Name | N-(4-tert-butylphenyl)-4-[9-(4-tert-butylphenyl)carbazol-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 143859069 |
| Molecular Formula | C44H42N2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-[9-(4-tert-butylphenyl)carbazol-3-yl]-N-phenylaniline |
| SMILES | CC(C)(C)c1ccc(N(c2ccccc2)c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3ccc(C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H42N2/c1-43(2,3)33-19-25-37(26-20-33)45(35-12-8-7-9-13-35)36-23-16-31(17-24-36)32-18-29-42-40(30-32)39-14-10-11-15-41(39)46(42)38-27-21-34(22-28-38)44(4,5)6/h7-30H,1-6H3 |
| InChIKey | YQYJIVYHFMDYIJ-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |