C9H9N5 — CID 143859469
5-amino-1-(2,5-dihydropyridin-2-yl)pyrazole-4-carbonitrile (PubChem CID 143859469) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is 5-amino-1-(2,5-dihydropyridin-2-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(2,5-dihydropyridin-2-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 143859469 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 5-amino-1-(2,5-dihydropyridin-2-yl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(C2C=CCC=N2)c1N |
| InChI | InChI=1S/C9H9N5/c10-5-7-6-13-14(9(7)11)8-3-1-2-4-12-8/h1,3-4,6,8H,2,11H2 |
| InChIKey | ZRFLJPMOFAWIGO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|