C10H11N5 — CID 143859578
5-amino-1-[(1E)-1-(ethylideneamino)buta-1,3-dien-2-yl]pyrazole-4-carbonitrile (PubChem CID 143859578) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-amino-1-[(1E)-1-(ethylideneamino)buta-1,3-dien-2-yl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[(1E)-1-(ethylideneamino)buta-1,3-dien-2-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 143859578 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 5-amino-1-[(1E)-1-(ethylideneamino)buta-1,3-dien-2-yl]pyrazole-4-carbonitrile |
| SMILES | C=C/C(=C\N=C\C)n1ncc(C#N)c1N |
| InChI | InChI=1S/C10H11N5/c1-3-9(7-13-4-2)15-10(12)8(5-11)6-14-15/h3-4,6-7H,1,12H2,2H3/b9-7+,13-4+ |
| InChIKey | GXAGWMBRHYVETK-CKLXFCMWSA-N |
| XLogP | 1.41 |
| TPSA | 79.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|