methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate

C16H20O2 — CID 143860011

IUPACmethyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate
SMILESCOC(=O)c1ccc(C)c(C2=CCCC2(C)C)c1
InChIInChI=1S/C16H20O2/c1-11-7-8-12(15(17)18-4)10-13(11)14-6-5-9-16(14,2)3/h6-8,10H,5,9H2,1-4H3
InChIKeyCKTPMGCNQKPAOT-UHFFFAOYSA-N
MW244.33 g/mol
LogP3.99
Rot. Bonds2

About methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate

methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate (PubChem CID 143860011) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate.

Molecular Properties

Compound Namemethyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate
PubChem CID143860011
Molecular FormulaC16H20O2
Molecular Weight244.33 g/mol
Exact Mass244.15
IUPAC Namemethyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate
SMILESCOC(=O)c1ccc(C)c(C2=CCCC2(C)C)c1
InChIInChI=1S/C16H20O2/c1-11-7-8-12(15(17)18-4)10-13(11)14-6-5-9-16(14,2)3/h6-8,10H,5,9H2,1-4H3
InChIKeyCKTPMGCNQKPAOT-UHFFFAOYSA-N
XLogP3.99
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.33
LogP ≤ 53.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate?
The IUPAC name of methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate (CID 143860011) is methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate.
What is the SMILES notation for methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate?
The canonical SMILES for methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate is COC(=O)c1ccc(C)c(C2=CCCC2(C)C)c1.
What is the InChIKey of methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate?
The InChIKey is CKTPMGCNQKPAOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O2/c1-11-7-8-12(15(17)18-4)10-13(11)14-6-5-9-16(14,2)3/h6-8,10H,5,9H2,1-4H3.
What are the key properties of methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate?
methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate has a molecular weight of 244.33 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate is sourced from PubChem (CID 143860011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).