C16H20O2 — CID 143860011
methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate (PubChem CID 143860011) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate.
| Compound Name | methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate |
|---|---|
| PubChem CID | 143860011 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | methyl 3-(5,5-dimethylcyclopenten-1-yl)-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(C2=CCCC2(C)C)c1 |
| InChI | InChI=1S/C16H20O2/c1-11-7-8-12(15(17)18-4)10-13(11)14-6-5-9-16(14,2)3/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | CKTPMGCNQKPAOT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |