C14H18N4 — CID 143860341
ethane;3-[(3E)-hexa-1,3,5-trien-3-yl]-2H-pyrazolo[3,4-b]pyridin-5-amine (PubChem CID 143860341) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is ethane;3-[(3E)-hexa-1,3,5-trien-3-yl]-2H-pyrazolo[3,4-b]pyridin-5-amine.
| Compound Name | ethane;3-[(3E)-hexa-1,3,5-trien-3-yl]-2H-pyrazolo[3,4-b]pyridin-5-amine |
|---|---|
| PubChem CID | 143860341 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | ethane;3-[(3E)-hexa-1,3,5-trien-3-yl]-2H-pyrazolo[3,4-b]pyridin-5-amine |
| SMILES | C=C/C=C(\C=C)c1[nH]nc2ncc(N)cc12.CC |
| InChI | InChI=1S/C12H12N4.C2H6/c1-3-5-8(4-2)11-10-6-9(13)7-14-12(10)16-15-11;1-2/h3-7H,1-2,13H2,(H,14,15,16);1-2H3/b8-5+; |
| InChIKey | WHDUEKJMFMFMSN-HAAWTFQLSA-N |
| XLogP | 3.32 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|