About 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid
4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid (PubChem CID 143860506) has the molecular formula C23H38O4
and a molecular weight of 378.55 g/mol. Its IUPAC name is 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid |
| PubChem CID | 143860506 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid |
| SMILES | CCC1(C(O)CCCC2CCCC2)CCC1.CCCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C15H28O.C8H10O3/c1-2-15(11-6-12-15)14(16)10-5-9-13-7-3-4-8-13;1-2-3-6-4-5-7(11-6)8(9)10/h13-14,16H,2-12H2,1H3;4-5H,2-3H2,1H3,(H,9,10) |
| InChIKey | UQEGVOSFAZLORH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid?
The IUPAC name of 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid (CID 143860506) is 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid.
What is the SMILES notation for 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid?
The canonical SMILES for 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid is CCC1(C(O)CCCC2CCCC2)CCC1.CCCc1ccc(C(=O)O)o1.
What is the InChIKey of 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid?
The InChIKey is UQEGVOSFAZLORH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O.C8H10O3/c1-2-15(11-6-12-15)14(16)10-5-9-13-7-3-4-8-13;1-2-3-6-4-5-7(11-6)8(9)10/h13-14,16H,2-12H2,1H3;4-5H,2-3H2,1H3,(H,9,10).
What are the key properties of 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid?
4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid has a molecular weight of 378.55 g/mol, XLogP of 6.22, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-1-(1-ethylcyclobutyl)butan-1-ol;5-propylfuran-2-carboxylic acid is sourced from PubChem (CID 143860506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).