About S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate
S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate (PubChem CID 14386114) has the molecular formula C12H15ClO2S
and a molecular weight of 258.77 g/mol. Its IUPAC name is S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate.
Molecular Properties
| Compound Name | S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate |
| PubChem CID | 14386114 |
| Molecular Formula | C12H15ClO2S |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate |
| SMILES | CCSC(=O)[C@@H](C)[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClO2S/c1-3-16-12(15)8(2)11(14)9-4-6-10(13)7-5-9/h4-8,11,14H,3H2,1-2H3/t8-,11-/m0/s1 |
| InChIKey | PJTIPANZLIKPCA-KWQFWETISA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate?
The IUPAC name of S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate (CID 14386114) is S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate.
What is the SMILES notation for S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate?
The canonical SMILES for S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate is CCSC(=O)[C@@H](C)[C@H](O)c1ccc(Cl)cc1.
What is the InChIKey of S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate?
The InChIKey is PJTIPANZLIKPCA-KWQFWETISA-N. The full InChI is InChI=1S/C12H15ClO2S/c1-3-16-12(15)8(2)11(14)9-4-6-10(13)7-5-9/h4-8,11,14H,3H2,1-2H3/t8-,11-/m0/s1.
What are the key properties of S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate?
S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate has a molecular weight of 258.77 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (2S,3S)-3-(4-chlorophenyl)-3-hydroxy-2-methylpropanethioate is sourced from PubChem (CID 14386114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).