About azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+)
azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+) (PubChem CID 143861641) has the molecular formula C10H12N4PtS2
and a molecular weight of 447.45 g/mol. Its IUPAC name is azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+).
Molecular Properties
| Compound Name | azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+) |
| PubChem CID | 143861641 |
| Molecular Formula | C10H12N4PtS2 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+) |
| SMILES | Cc1cc2nc([S-])c([S-])nc2cc1C.[NH2-].[NH2-].[Pt+4] |
| InChI | InChI=1S/C10H10N2S2.2H2N.Pt/c1-5-3-7-8(4-6(5)2)12-10(14)9(13)11-7;;;/h3-4H,1-2H3,(H,11,13)(H,12,14);2*1H2;/q;2*-1;+4/p-2 |
| InChIKey | ISMMSROECBADTL-UHFFFAOYSA-L |
| XLogP | 3.49 |
| TPSA | 92.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+)?
The IUPAC name of azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+) (CID 143861641) is azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+).
What is the SMILES notation for azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+)?
The canonical SMILES for azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+) is Cc1cc2nc([S-])c([S-])nc2cc1C.[NH2-].[NH2-].[Pt+4].
What is the InChIKey of azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+)?
The InChIKey is ISMMSROECBADTL-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H10N2S2.2H2N.Pt/c1-5-3-7-8(4-6(5)2)12-10(14)9(13)11-7;;;/h3-4H,1-2H3,(H,11,13)(H,12,14);2*1H2;/q;2*-1;+4/p-2.
What are the key properties of azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+)?
azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+) has a molecular weight of 447.45 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;6,7-dimethylquinoxaline-2,3-dithiolate;platinum(4+) is sourced from PubChem (CID 143861641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).