C27H40N6O2 — CID 143861869
(10E,12E,14E)-11,12,15-trimethyl-4-morpholin-4-yl-16-oxa-1,8,10,19-tetrazatricyclo[18.2.2.13,7]pentacosa-3,5,7(25),8,10,12,14-heptaen-9-amine (PubChem CID 143861869) has the molecular formula C27H40N6O2 and a molecular weight of 480.66 g/mol. Its IUPAC name is (10E,12E,14E)-11,12,15-trimethyl-4-morpholin-4-yl-16-oxa-1,8,10,19-tetrazatricyclo[18.2.2.13,7]pentacosa-3,5,7(25),8,10,12,14-heptaen-9-amine.
| Compound Name | (10E,12E,14E)-11,12,15-trimethyl-4-morpholin-4-yl-16-oxa-1,8,10,19-tetrazatricyclo[18.2.2.13,7]pentacosa-3,5,7(25),8,10,12,14-heptaen-9-amine |
|---|---|
| PubChem CID | 143861869 |
| Molecular Formula | C27H40N6O2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | (10E,12E,14E)-11,12,15-trimethyl-4-morpholin-4-yl-16-oxa-1,8,10,19-tetrazatricyclo[18.2.2.13,7]pentacosa-3,5,7(25),8,10,12,14-heptaen-9-amine |
| SMILES | CC1=N/C(N)=N/c2ccc(N3CCOCC3)c(c2)CN2CCC(CC2)NCCO/C(C)=C\C=C\1C |
| InChI | InChI=1S/C27H40N6O2/c1-20-4-5-21(2)35-15-10-29-24-8-11-32(12-9-24)19-23-18-25(31-27(28)30-22(20)3)6-7-26(23)33-13-16-34-17-14-33/h4-7,18,24,29H,8-17,19H2,1-3H3,(H2,28,31)/b20-4+,21-5+,30-22- |
| InChIKey | XUPQOFDTSVSZGL-UUXSIBCHSA-N |
| XLogP | 3.36 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|