C11H14F6O2 — CID 143862894
2-[(2E,4E)-3,5-bis(trifluoromethyl)hepta-2,4-dienoxy]ethanol (PubChem CID 143862894) has the molecular formula C11H14F6O2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 2-[(2E,4E)-3,5-bis(trifluoromethyl)hepta-2,4-dienoxy]ethanol.
| Compound Name | 2-[(2E,4E)-3,5-bis(trifluoromethyl)hepta-2,4-dienoxy]ethanol |
|---|---|
| PubChem CID | 143862894 |
| Molecular Formula | C11H14F6O2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[(2E,4E)-3,5-bis(trifluoromethyl)hepta-2,4-dienoxy]ethanol |
| SMILES | CC/C(=C\C(=C/COCCO)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F6O2/c1-2-8(10(12,13)14)7-9(11(15,16)17)3-5-19-6-4-18/h3,7,18H,2,4-6H2,1H3/b8-7+,9-3+ |
| InChIKey | QPZVJIKHCLUXJL-JFZQOVMVSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|