C22H28N2O — CID 143863826
1-(5-methoxycyclohepta-1,3,4,6-tetraen-1-yl)-N-[(2-piperidin-1-ylcyclohepta-1,4,6-trien-1-yl)methyl]methanamine (PubChem CID 143863826) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-(5-methoxycyclohepta-1,3,4,6-tetraen-1-yl)-N-[(2-piperidin-1-ylcyclohepta-1,4,6-trien-1-yl)methyl]methanamine.
| Compound Name | 1-(5-methoxycyclohepta-1,3,4,6-tetraen-1-yl)-N-[(2-piperidin-1-ylcyclohepta-1,4,6-trien-1-yl)methyl]methanamine |
|---|---|
| PubChem CID | 143863826 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-(5-methoxycyclohepta-1,3,4,6-tetraen-1-yl)-N-[(2-piperidin-1-ylcyclohepta-1,4,6-trien-1-yl)methyl]methanamine |
| SMILES | COC1=C=CC=C(CNCC2=C(N3CCCCC3)CC=CC=C2)C=C1 |
| InChI | InChI=1S/C22H28N2O/c1-25-21-11-8-9-19(13-14-21)17-23-18-20-10-4-2-5-12-22(20)24-15-6-3-7-16-24/h2,4-5,8-10,13-14,23H,3,6-7,12,15-18H2,1H3 |
| InChIKey | ARBBEHISMCEMAT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |