C21H31NO2S — CID 143863960
ethane;4-methoxy-2,6-dimethylbenzenethiol;1,2,3,4-tetrahydroquinolin-2-ylmethanol (PubChem CID 143863960) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is ethane;4-methoxy-2,6-dimethylbenzenethiol;1,2,3,4-tetrahydroquinolin-2-ylmethanol.
| Compound Name | ethane;4-methoxy-2,6-dimethylbenzenethiol;1,2,3,4-tetrahydroquinolin-2-ylmethanol |
|---|---|
| PubChem CID | 143863960 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | ethane;4-methoxy-2,6-dimethylbenzenethiol;1,2,3,4-tetrahydroquinolin-2-ylmethanol |
| SMILES | CC.COc1cc(C)c(S)c(C)c1.OCC1CCc2ccccc2N1 |
| InChI | InChI=1S/C10H13NO.C9H12OS.C2H6/c12-7-9-6-5-8-3-1-2-4-10(8)11-9;1-6-4-8(10-3)5-7(2)9(6)11;1-2/h1-4,9,11-12H,5-7H2;4-5,11H,1-3H3;1-2H3 |
| InChIKey | FBJTTXQJRWJHEQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|