C20H27FO4S — CID 143864063
4-[2-[2-[(2R)-2-fluorobut-3-en-2-yl]phenyl]sulfonylcyclohexyl]butanoic acid (PubChem CID 143864063) has the molecular formula C20H27FO4S and a molecular weight of 382.50 g/mol. Its IUPAC name is 4-[2-[2-[(2R)-2-fluorobut-3-en-2-yl]phenyl]sulfonylcyclohexyl]butanoic acid.
| Compound Name | 4-[2-[2-[(2R)-2-fluorobut-3-en-2-yl]phenyl]sulfonylcyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 143864063 |
| Molecular Formula | C20H27FO4S |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-[2-[2-[(2R)-2-fluorobut-3-en-2-yl]phenyl]sulfonylcyclohexyl]butanoic acid |
| SMILES | C=C[C@@](C)(F)c1ccccc1S(=O)(=O)C1CCCCC1CCCC(=O)O |
| InChI | InChI=1S/C20H27FO4S/c1-3-20(2,21)16-11-5-7-13-18(16)26(24,25)17-12-6-4-9-15(17)10-8-14-19(22)23/h3,5,7,11,13,15,17H,1,4,6,8-10,12,14H2,2H3,(H,22,23)/t15?,17?,20-/m1/s1 |
| InChIKey | OYDASDMVFNEISN-MKJPBZQASA-N |
| XLogP | 4.64 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|