C22H26F3NO4S — CID 143864070
tert-butyl 2-(3,4-dihydro-2H-1,4-benzoxazin-3-ylmethoxy)acetate;2-(trifluoromethyl)benzenethiol (PubChem CID 143864070) has the molecular formula C22H26F3NO4S and a molecular weight of 457.51 g/mol. Its IUPAC name is tert-butyl 2-(3,4-dihydro-2H-1,4-benzoxazin-3-ylmethoxy)acetate;2-(trifluoromethyl)benzenethiol.
| Compound Name | tert-butyl 2-(3,4-dihydro-2H-1,4-benzoxazin-3-ylmethoxy)acetate;2-(trifluoromethyl)benzenethiol |
|---|---|
| PubChem CID | 143864070 |
| Molecular Formula | C22H26F3NO4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | tert-butyl 2-(3,4-dihydro-2H-1,4-benzoxazin-3-ylmethoxy)acetate;2-(trifluoromethyl)benzenethiol |
| SMILES | CC(C)(C)OC(=O)COCC1COc2ccccc2N1.FC(F)(F)c1ccccc1S |
| InChI | InChI=1S/C15H21NO4.C7H5F3S/c1-15(2,3)20-14(17)10-18-8-11-9-19-13-7-5-4-6-12(13)16-11;8-7(9,10)5-3-1-2-4-6(5)11/h4-7,11,16H,8-10H2,1-3H3;1-4,11H |
| InChIKey | UTPKPBYCIGBBLN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|