C28H35Cl2N5O — CID 143864395
N-[(2E)-2-[(E)-2,3-dichloroprop-1-enyl]penta-2,4-dienyl]-2-phenyl-N-(2-pyridin-2-ylethanimidoyl)ethanimidamide;formamide;2-methylprop-1-ene (PubChem CID 143864395) has the molecular formula C28H35Cl2N5O and a molecular weight of 528.53 g/mol. Its IUPAC name is N-[(2E)-2-[(E)-2,3-dichloroprop-1-enyl]penta-2,4-dienyl]-2-phenyl-N-(2-pyridin-2-ylethanimidoyl)ethanimidamide;formamide;2-methylprop-1-ene.
| Compound Name | N-[(2E)-2-[(E)-2,3-dichloroprop-1-enyl]penta-2,4-dienyl]-2-phenyl-N-(2-pyridin-2-ylethanimidoyl)ethanimidamide;formamide;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143864395 |
| Molecular Formula | C28H35Cl2N5O |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | N-[(2E)-2-[(E)-2,3-dichloroprop-1-enyl]penta-2,4-dienyl]-2-phenyl-N-(2-pyridin-2-ylethanimidoyl)ethanimidamide;formamide;2-methylprop-1-ene |
| SMILES | C=C(C)C.NC=O.[H]/N=C(/Cc1ccccn1)N(CC(/C=C(/Cl)CCl)=C/C=C)/C(Cc1ccccc1)=N/[H] |
| InChI | InChI=1S/C23H24Cl2N4.C4H8.CH3NO/c1-2-8-19(13-20(25)16-24)17-29(22(26)14-18-9-4-3-5-10-18)23(27)15-21-11-6-7-12-28-21;1-4(2)3;2-1-3/h2-13,26-27H,1,14-17H2;1H2,2-3H3;1H,(H2,2,3)/b19-8+,20-13+,26-22+,27-23-;; |
| InChIKey | PIGYGFYCIDTGGX-NDVAIRKISA-N |
| XLogP | 6.28 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|