C16H24N6OS — CID 143864526
N-(4-aminophenyl)sulfinyl-N'-ethyl-2,3,8-triazaspiro[4.5]dec-3-ene-2-carboximidamide (PubChem CID 143864526) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is N-(4-aminophenyl)sulfinyl-N'-ethyl-2,3,8-triazaspiro[4.5]dec-3-ene-2-carboximidamide.
| Compound Name | N-(4-aminophenyl)sulfinyl-N'-ethyl-2,3,8-triazaspiro[4.5]dec-3-ene-2-carboximidamide |
|---|---|
| PubChem CID | 143864526 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-(4-aminophenyl)sulfinyl-N'-ethyl-2,3,8-triazaspiro[4.5]dec-3-ene-2-carboximidamide |
| SMILES | CC/N=C(\NS(=O)c1ccc(N)cc1)N1CC2(C=N1)CCNCC2 |
| InChI | InChI=1S/C16H24N6OS/c1-2-19-15(21-24(23)14-5-3-13(17)4-6-14)22-12-16(11-20-22)7-9-18-10-8-16/h3-6,11,18H,2,7-10,12,17H2,1H3,(H,19,21) |
| InChIKey | GCKILNIQMULTRB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|