C25H30N8OS — CID 143864617
N-[4-[4-(6-amino-5-methoxy-3-pyridinyl)-2-phenyl-1H-imidazol-5-yl]pyrimidin-2-yl]-N'-butan-2-ylsulfanylethane-1,2-diamine (PubChem CID 143864617) has the molecular formula C25H30N8OS and a molecular weight of 490.64 g/mol. Its IUPAC name is N-[4-[4-(6-amino-5-methoxy-3-pyridinyl)-2-phenyl-1H-imidazol-5-yl]pyrimidin-2-yl]-N'-butan-2-ylsulfanylethane-1,2-diamine.
| Compound Name | N-[4-[4-(6-amino-5-methoxy-3-pyridinyl)-2-phenyl-1H-imidazol-5-yl]pyrimidin-2-yl]-N'-butan-2-ylsulfanylethane-1,2-diamine |
|---|---|
| PubChem CID | 143864617 |
| Molecular Formula | C25H30N8OS |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-[4-[4-(6-amino-5-methoxy-3-pyridinyl)-2-phenyl-1H-imidazol-5-yl]pyrimidin-2-yl]-N'-butan-2-ylsulfanylethane-1,2-diamine |
| SMILES | CCC(C)SNCCNc1nccc(-c2[nH]c(-c3ccccc3)nc2-c2cnc(N)c(OC)c2)n1 |
| InChI | InChI=1S/C25H30N8OS/c1-4-16(2)35-30-13-12-28-25-27-11-10-19(31-25)22-21(18-14-20(34-3)23(26)29-15-18)32-24(33-22)17-8-6-5-7-9-17/h5-11,14-16,30H,4,12-13H2,1-3H3,(H2,26,29)(H,32,33)(H,27,28,31) |
| InChIKey | NCARYKDGGIKLIN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|