C7H10ClN — CID 143864822
3-chloro-2,5-dimethyl-2,3-dihydropyridine (PubChem CID 143864822) has the molecular formula C7H10ClN and a molecular weight of 143.62 g/mol. Its IUPAC name is 3-chloro-2,5-dimethyl-2,3-dihydropyridine.
| Compound Name | 3-chloro-2,5-dimethyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 143864822 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 3-chloro-2,5-dimethyl-2,3-dihydropyridine |
| SMILES | CC1=CC(Cl)C(C)N=C1 |
| InChI | InChI=1S/C7H10ClN/c1-5-3-7(8)6(2)9-4-5/h3-4,6-7H,1-2H3 |
| InChIKey | SKFRSLPSGTZWHQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|