About ethane;1-methylimidazole-4,5-dicarbohydrazide
ethane;1-methylimidazole-4,5-dicarbohydrazide (PubChem CID 143864935) has the molecular formula C8H16N6O2
and a molecular weight of 228.26 g/mol. Its IUPAC name is ethane;1-methylimidazole-4,5-dicarbohydrazide.
Molecular Properties
| Compound Name | ethane;1-methylimidazole-4,5-dicarbohydrazide |
| PubChem CID | 143864935 |
| Molecular Formula | C8H16N6O2 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | ethane;1-methylimidazole-4,5-dicarbohydrazide |
| SMILES | CC.Cn1cnc(C(=O)NN)c1C(=O)NN |
| InChI | InChI=1S/C6H10N6O2.C2H6/c1-12-2-9-3(5(13)10-7)4(12)6(14)11-8;1-2/h2H,7-8H2,1H3,(H,10,13)(H,11,14);1-2H3 |
| InChIKey | ZLXPBDYYQYWWDR-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methylimidazole-4,5-dicarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylimidazole-4,5-dicarbohydrazide?
The IUPAC name of ethane;1-methylimidazole-4,5-dicarbohydrazide (CID 143864935) is ethane;1-methylimidazole-4,5-dicarbohydrazide.
What is the SMILES notation for ethane;1-methylimidazole-4,5-dicarbohydrazide?
The canonical SMILES for ethane;1-methylimidazole-4,5-dicarbohydrazide is CC.Cn1cnc(C(=O)NN)c1C(=O)NN.
What is the InChIKey of ethane;1-methylimidazole-4,5-dicarbohydrazide?
The InChIKey is ZLXPBDYYQYWWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N6O2.C2H6/c1-12-2-9-3(5(13)10-7)4(12)6(14)11-8;1-2/h2H,7-8H2,1H3,(H,10,13)(H,11,14);1-2H3.
What are the key properties of ethane;1-methylimidazole-4,5-dicarbohydrazide?
ethane;1-methylimidazole-4,5-dicarbohydrazide has a molecular weight of 228.26 g/mol, XLogP of -1.35, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylimidazole-4,5-dicarbohydrazide is sourced from PubChem (CID 143864935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).