About 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one
1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one (PubChem CID 143865279) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one |
| PubChem CID | 143865279 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one |
| SMILES | Cc1cccc(CC(=O)CC2=CC(C(C)C)=CC2)c1 |
| InChI | InChI=1S/C18H22O/c1-13(2)17-8-7-16(10-17)12-18(19)11-15-6-4-5-14(3)9-15/h4-6,8-10,13H,7,11-12H2,1-3H3 |
| InChIKey | GGKWCLIBOMDPIO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one?
The IUPAC name of 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one (CID 143865279) is 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one.
What is the SMILES notation for 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one?
The canonical SMILES for 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one is Cc1cccc(CC(=O)CC2=CC(C(C)C)=CC2)c1.
What is the InChIKey of 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one?
The InChIKey is GGKWCLIBOMDPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O/c1-13(2)17-8-7-16(10-17)12-18(19)11-15-6-4-5-14(3)9-15/h4-6,8-10,13H,7,11-12H2,1-3H3.
What are the key properties of 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one?
1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one has a molecular weight of 254.37 g/mol, XLogP of 4.41, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylphenyl)-3-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)propan-2-one is sourced from PubChem (CID 143865279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).