About (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol
(2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol (PubChem CID 143865830) has the molecular formula C11H15NS
and a molecular weight of 193.31 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol.
Molecular Properties
| Compound Name | (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol |
| PubChem CID | 143865830 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol |
| SMILES | C=C/C=c1/cccn/c1=C/C.CS |
| InChI | InChI=1S/C10H11N.CH4S/c1-3-6-9-7-5-8-11-10(9)4-2;1-2/h3-8H,1H2,2H3;2H,1H3/b9-6-,10-4+; |
| InChIKey | KBLBDEHVASCKHD-OYQBFJTMSA-N |
| XLogP | 1.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol?
The IUPAC name of (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol (CID 143865830) is (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol.
What is the SMILES notation for (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol?
The canonical SMILES for (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol is C=C/C=c1/cccn/c1=C/C.CS.
What is the InChIKey of (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol?
The InChIKey is KBLBDEHVASCKHD-OYQBFJTMSA-N. The full InChI is InChI=1S/C10H11N.CH4S/c1-3-6-9-7-5-8-11-10(9)4-2;1-2/h3-8H,1H2,2H3;2H,1H3/b9-6-,10-4+;.
What are the key properties of (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol?
(2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol has a molecular weight of 193.31 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2-ethylidene-3-prop-2-enylidenepyridine;methanethiol is sourced from PubChem (CID 143865830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).