About 4-methoxy-4-methylthiane
4-methoxy-4-methylthiane (PubChem CID 143866445) has the molecular formula C7H14OS
and a molecular weight of 146.25 g/mol. Its IUPAC name is 4-methoxy-4-methylthiane.
Molecular Properties
| Compound Name | 4-methoxy-4-methylthiane |
| PubChem CID | 143866445 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 4-methoxy-4-methylthiane |
| SMILES | COC1(C)CCSCC1 |
| InChI | InChI=1S/C7H14OS/c1-7(8-2)3-5-9-6-4-7/h3-6H2,1-2H3 |
| InChIKey | NFYMHHBJYQPIHD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-4-methylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-4-methylthiane?
The IUPAC name of 4-methoxy-4-methylthiane (CID 143866445) is 4-methoxy-4-methylthiane.
What is the SMILES notation for 4-methoxy-4-methylthiane?
The canonical SMILES for 4-methoxy-4-methylthiane is COC1(C)CCSCC1.
What is the InChIKey of 4-methoxy-4-methylthiane?
The InChIKey is NFYMHHBJYQPIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OS/c1-7(8-2)3-5-9-6-4-7/h3-6H2,1-2H3.
What are the key properties of 4-methoxy-4-methylthiane?
4-methoxy-4-methylthiane has a molecular weight of 146.25 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-4-methylthiane is sourced from PubChem (CID 143866445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).